weezer010902 weezer010902

03-11-2019
Chemistry

contestada

How many moles of oxygen are required to produce 4 moles of water?

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn maizetycorn

03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles H2O

Answer Link

soniaaguirre01234 soniaaguirre01234

03-11-2019

6. How do I know? Just took the test boyy

Answer Link

Otras preguntas

How atoms and molecules are important to cell processes?

The conflict that occurs between an accused person and a tiger can best be described as— A. character vs. another character B. character vs. internalized social

$1080 in the ratio of 1:3:5

-2/5n=-30 n=? Please help me with my math! 10 PTNS!!

What is the structure that surrounds the cytoplasm in a bacterial cell

Which decimals are greater than –6.7? Choose all answers that are correct. a. –8.9 b. –6.72 c. –6.1 d. –3.54

Write a metaphor about someone who is very stubborn

Which city state appears to control the Greek peninsula?

What impact did the u.s supreme court case Griswold v. Connecticut have on women's rights

how can we make the world a better and healthier place?