Vadel7818 Vadel7818

03-01-2023
English

contestada

Addressing the families of the astronauts is mainly an appeal to____.

Respuesta :

2024valdezisabella 2024valdezisabella

03-01-2023

Answer:

Pathos

Explanation: It appeals to the emotions and feelings of others.

Answer Link

Otras preguntas

-50 points- matrix system

Consider Kodak's core competency before Fisher's arrival. As the market shifted from film to digital did the company's historical core competency still quality

thA sum of Rs. 700 grows by 1/20 of itself every year. At what time would it amout to Rs.1050? a) 8 yearsb) 10 yearsc) 12 years d) 15 years

A variety of two types of snack packs are delivered to a store. The box plots compare the number of calories in each snack pack of crackers to the number of cal

What is the relationship between the "racial composition" map and the "grades of security" map? How has your neighborhood changed since 1935?

If the probability that a person will die in the next year is 771/100,000 what is the probability that the person will not die in the next year? A. 0.771% B. 99

compare the life of a spartan male with the life of an american male today

How can I find friend from abroad ?

Find the distance between (-8, 4) and (-8, -2).10 units2 units6 units8 units

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl